BisAdam8029 BisAdam8029

02-11-2017
Biology

contestada

During adolescence, a condition where the body parts grow unevenly is known as _____.

Respuesta :

spacemt08 spacemt08

02-11-2017

This condition is known as asynchrony.

Answer Link

Otras preguntas

Explain why aluminium resists corrosion but iron does not.Explain the term culling as used in livestock management.thr(a)(ii)State two methods of preventing iro

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

Why does Hollis compare foster kids to being dropped off like a UPS delivery

Compute 3/10 + 3/5 - 1/5

.J. is struggling with whether or not it is worth trying to quit his prescription drug abuse. He used to be dedicated to his family and friends, but he worries

D( Geese fly in V formation. The V forms a right angle that has 16 geese on 1 side and 12 geese on the other side. How many gesse would fill in the gap betw

Question #2: Make a sentence by adding the correct group of words. During the birthday party _______. A.the one-year-old cried B.the one-year-old crying and eat

ASAP Which of the following factors determine a plane? A. line and a point on the line B. two lines C. a straight line D. a line and a point not on that line

Who painted the image seen below? The Ognissanti Madonna. Jeremiah and Isaiah look up to a child held by its mother surrounded by angels. The painting has depth

**50 points Once again and brainliest** Please hurry ;w;