elpink25 elpink25

02-10-2017
Mathematics

contestada

is c+3/5=15 an identity

Respuesta :

Cupxake Cupxake

02-10-2017

no, becuase c has to be a certain number to equal 15

Answer Link

Otras preguntas

I know the right answer to this I just don't know how to get it, please help. what is the product in simplest form? State any restrictions on the variable. (x^2

Which functional group allows the sugar glucose to dissolve in blood?

What’s the solution to (-3i+3i)+(-2+3i)

triangle M is similar to triangle N . Triangle M has 2 angles with measures of 32 degrees and 93 degrees . Which 2 angles could be included in triangle N ?

When bits of wood or other materials are set into the surface of wood furniture, the result is known as A. ormolu. B. lacquering. C. gilding.

In which conflict was containment successful? A) the Korean War B) the Vietnam War C) the Cuban Missile Crisis D) the Communist Revolution

When muscles are contracting under oxygen deficient conditions, they will form ________ to ensure they maintain a supply of atp?

What are the verbal phrases in the following sentences. Identify the phrase as a participle, a gerund, or a verb. 1. After arguing with the captain of his vesse

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

What is the value of the expression when y=2